About (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone
(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 58477896) has the molecular formula C25H21NO4S
and a molecular weight of 431.51 g/mol. Its IUPAC name is (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 58477896 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1cc(C(=O)c2csc(-c3ccccc3)n2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H21NO4S/c1-28-21-13-19(14-22(29-2)24(21)30-15-17-9-5-3-6-10-17)23(27)20-16-31-25(26-20)18-11-7-4-8-12-18/h3-14,16H,15H2,1-2H3 |
| InChIKey | IKYKXYXXULRQHL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone (CID 58477896) is (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone is COc1cc(C(=O)c2csc(-c3ccccc3)n2)cc(OC)c1OCc1ccccc1.
What is the InChIKey of (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone?
The InChIKey is IKYKXYXXULRQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO4S/c1-28-21-13-19(14-22(29-2)24(21)30-15-17-9-5-3-6-10-17)23(27)20-16-31-25(26-20)18-11-7-4-8-12-18/h3-14,16H,15H2,1-2H3.
What are the key properties of (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone?
(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone has a molecular weight of 431.51 g/mol, XLogP of 5.64, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 58477896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).