C26H23NO4S2 — CID 58478459
(2S)-2,3,3-trideuterio-3-(2,4,6,7-tetradeuterio-5-methyl-1H-indol-3-yl)-2-[[5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]propanoic acid (PubChem CID 58478459) has the molecular formula C26H23NO4S2 and a molecular weight of 488.67 g/mol. Its IUPAC name is (2S)-2,3,3-trideuterio-3-(2,4,6,7-tetradeuterio-5-methyl-1H-indol-3-yl)-2-[[5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]propanoic acid.
| Compound Name | (2S)-2,3,3-trideuterio-3-(2,4,6,7-tetradeuterio-5-methyl-1H-indol-3-yl)-2-[[5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]propanoic acid |
|---|---|
| PubChem CID | 58478459 |
| Molecular Formula | C26H23NO4S2 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2S)-2,3,3-trideuterio-3-(2,4,6,7-tetradeuterio-5-methyl-1H-indol-3-yl)-2-[[5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]propanoic acid |
| SMILES | [2H]c1[nH]c2c([2H])c([2H])c(C)c([2H])c2c1C([2H])([2H])[C@]([2H])(CS(=O)(=O)c1ccc(C#Cc2c([2H])c([2H])c(C)c([2H])c2[2H])s1)C(=O)O |
| InChI | InChI=1S/C26H23NO4S2/c1-17-3-6-19(7-4-17)8-9-22-10-12-25(32-22)33(30,31)16-21(26(28)29)14-20-15-27-24-11-5-18(2)13-23(20)24/h3-7,10-13,15,21,27H,14,16H2,1-2H3,(H,28,29)/t21-/m1/s1/i3D,4D,5D,6D,7D,11D,13D,14D2,15D,21D |
| InChIKey | MTFOBCJMNUHKFV-KXMFBLJCSA-N |
| XLogP | 4.96 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|