About 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane
2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane (PubChem CID 58478643) has the molecular formula C12H17F3O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane.
Molecular Properties
| Compound Name | 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane |
| PubChem CID | 58478643 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane |
| SMILES | C#CCC1CCC(CCCCC(F)(F)F)O1 |
| InChI | InChI=1S/C12H17F3O/c1-2-5-10-7-8-11(16-10)6-3-4-9-12(13,14)15/h1,10-11H,3-9H2 |
| InChIKey | JCUWIDGQPDUVNC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane?
The IUPAC name of 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane (CID 58478643) is 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane.
What is the SMILES notation for 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane?
The canonical SMILES for 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane is C#CCC1CCC(CCCCC(F)(F)F)O1.
What is the InChIKey of 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane?
The InChIKey is JCUWIDGQPDUVNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3O/c1-2-5-10-7-8-11(16-10)6-3-4-9-12(13,14)15/h1,10-11H,3-9H2.
What are the key properties of 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane?
2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane has a molecular weight of 234.26 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynyl-5-(5,5,5-trifluoropentyl)oxolane is sourced from PubChem (CID 58478643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).