C17H14N2O3S — CID 584789
2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-methylquinazolin-4-one (PubChem CID 584789) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-methylquinazolin-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 584789 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-methylquinazolin-4-one |
| SMILES | Cn1c(SCc2ccc3c(c2)OCO3)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H14N2O3S/c1-19-16(20)12-4-2-3-5-13(12)18-17(19)23-9-11-6-7-14-15(8-11)22-10-21-14/h2-8H,9-10H2,1H3 |
| InChIKey | ZJVIINRFNCLMFW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |