C24H22N2O3 — CID 58479318
4-[[5-[3-(1-hydroxyethenyl)-4-methylphenyl]furan-2-yl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one (PubChem CID 58479318) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[[5-[3-(1-hydroxyethenyl)-4-methylphenyl]furan-2-yl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one.
| Compound Name | 4-[[5-[3-(1-hydroxyethenyl)-4-methylphenyl]furan-2-yl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 58479318 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4-[[5-[3-(1-hydroxyethenyl)-4-methylphenyl]furan-2-yl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
| SMILES | C=C(O)c1cc(-c2ccc(CC3C(=O)N(c4ccccc4)N=C3C)o2)ccc1C |
| InChI | InChI=1S/C24H22N2O3/c1-15-9-10-18(13-21(15)17(3)27)23-12-11-20(29-23)14-22-16(2)25-26(24(22)28)19-7-5-4-6-8-19/h4-13,22,27H,3,14H2,1-2H3 |
| InChIKey | IXYUWGUCZPLXEX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|