C41H42F3N2OP — CID 58479380
[(4R,5R)-2-(2-dicyclohexylphosphanylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 58479380) has the molecular formula C41H42F3N2OP and a molecular weight of 666.77 g/mol. Its IUPAC name is [(4R,5R)-2-(2-dicyclohexylphosphanylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4R,5R)-2-(2-dicyclohexylphosphanylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58479380 |
| Molecular Formula | C41H42F3N2OP |
| Molecular Weight | 666.77 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | [(4R,5R)-2-(2-dicyclohexylphosphanylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1C(c2ccccc2P(C2CCCCC2)C2CCCCC2)=N[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C41H42F3N2OP/c42-41(43,44)32-27-25-31(26-28-32)40(47)46-38(30-17-7-2-8-18-30)37(29-15-5-1-6-16-29)45-39(46)35-23-13-14-24-36(35)48(33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-2,5-8,13-18,23-28,33-34,37-38H,3-4,9-12,19-22H2/t37-,38-/m1/s1 |
| InChIKey | JDABJTSYLMXZAZ-XPSQVAKYSA-N |
| XLogP | 10.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.77 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|