C21H44O6Si2 — CID 58479494
(3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybutan-2-one (PubChem CID 58479494) has the molecular formula C21H44O6Si2 and a molecular weight of 448.75 g/mol. Its IUPAC name is (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybutan-2-one.
| Compound Name | (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 58479494 |
| Molecular Formula | C21H44O6Si2 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybutan-2-one |
| SMILES | CC1(C)OC[C@@H]([C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H44O6Si2/c1-19(2,3)28(9,10)25-13-15(22)18(27-29(11,12)20(4,5)6)17(23)16-14-24-21(7,8)26-16/h16-18,23H,13-14H2,1-12H3/t16-,17-,18-/m0/s1 |
| InChIKey | DUOTWOQDBRRJLE-BZSNNMDCSA-N |
| XLogP | 4.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|