C16H32O5Si — CID 58479497
(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxypentan-3-one (PubChem CID 58479497) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxypentan-3-one.
| Compound Name | (1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxypentan-3-one |
|---|---|
| PubChem CID | 58479497 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxypentan-3-one |
| SMILES | CCC(=O)C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H32O5Si/c1-9-11(17)14(21-22(7,8)15(2,3)4)13(18)12-10-19-16(5,6)20-12/h12-14,18H,9-10H2,1-8H3/t12-,13-,14?/m0/s1 |
| InChIKey | PANGEFRHEHPABG-RFHHWMCGSA-N |
| XLogP | 2.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|