C17H26N2O8 — CID 58479500
methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2-diacetyloxybutyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 58479500) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2-diacetyloxybutyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2-diacetyloxybutyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 58479500 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2-diacetyloxybutyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C(=O)OC)=C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H26N2O8/c1-6-12(25-9(3)21)15(26-10(4)22)16-14(19-8(2)20)11(18)7-13(27-16)17(23)24-5/h7,11-12,14-16H,6,18H2,1-5H3,(H,19,20)/t11-,12+,14+,15+,16+/m0/s1 |
| InChIKey | BHAJDKREFQYTPJ-OVJXPFRRSA-N |
| XLogP | -0.45 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|