About [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate
[2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate (PubChem CID 58479535) has the molecular formula C15H22O6S3
and a molecular weight of 394.54 g/mol. Its IUPAC name is [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate |
| PubChem CID | 58479535 |
| Molecular Formula | C15H22O6S3 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate |
| SMILES | CCC(COC(=O)CCS)(C(=O)C(=O)CCS)C(=O)C(=O)CCS |
| InChI | InChI=1S/C15H22O6S3/c1-2-15(9-21-12(18)5-8-24,13(19)10(16)3-6-22)14(20)11(17)4-7-23/h22-24H,2-9H2,1H3 |
| InChIKey | HETVWSDQPXABDI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate?
The IUPAC name of [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate (CID 58479535) is [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate.
What is the SMILES notation for [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate?
The canonical SMILES for [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate is CCC(COC(=O)CCS)(C(=O)C(=O)CCS)C(=O)C(=O)CCS.
What is the InChIKey of [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate?
The InChIKey is HETVWSDQPXABDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O6S3/c1-2-15(9-21-12(18)5-8-24,13(19)10(16)3-6-22)14(20)11(17)4-7-23/h22-24H,2-9H2,1H3.
What are the key properties of [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate?
[2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate has a molecular weight of 394.54 g/mol, XLogP of 1.16, 13 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethyl-3,4-dioxo-2-(2-oxo-4-sulfanylbutanoyl)-6-sulfanylhexyl] 3-sulfanylpropanoate is sourced from PubChem (CID 58479535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).