C36H14F6N4 — CID 58479833
4,5,6-trifluoro-2-[5-(4,5,6-trifluoropyrimidin-2-yl)-12-heptacyclo[14.11.1.02,15.04,13.06,11.018,23.024,28]octacosa-1(27),2,4,6,8,10,12,14,16,18,20,22,24(28),25-tetradecaenyl]pyrimidine (PubChem CID 58479833) has the molecular formula C36H14F6N4 and a molecular weight of 616.52 g/mol. Its IUPAC name is 4,5,6-trifluoro-2-[5-(4,5,6-trifluoropyrimidin-2-yl)-12-heptacyclo[14.11.1.02,15.04,13.06,11.018,23.024,28]octacosa-1(27),2,4,6,8,10,12,14,16,18,20,22,24(28),25-tetradecaenyl]pyrimidine.
| Compound Name | 4,5,6-trifluoro-2-[5-(4,5,6-trifluoropyrimidin-2-yl)-12-heptacyclo[14.11.1.02,15.04,13.06,11.018,23.024,28]octacosa-1(27),2,4,6,8,10,12,14,16,18,20,22,24(28),25-tetradecaenyl]pyrimidine |
|---|---|
| PubChem CID | 58479833 |
| Molecular Formula | C36H14F6N4 |
| Molecular Weight | 616.52 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 4,5,6-trifluoro-2-[5-(4,5,6-trifluoropyrimidin-2-yl)-12-heptacyclo[14.11.1.02,15.04,13.06,11.018,23.024,28]octacosa-1(27),2,4,6,8,10,12,14,16,18,20,22,24(28),25-tetradecaenyl]pyrimidine |
| SMILES | Fc1nc(-c2c3ccccc3c(-c3nc(F)c(F)c(F)n3)c3cc4c(cc23)-c2cccc3c2c-4cc2ccccc23)nc(F)c1F |
| InChI | InChI=1S/C36H14F6N4/c37-29-31(39)43-35(44-32(29)40)27-18-8-3-4-9-19(18)28(36-45-33(41)30(38)34(42)46-36)25-14-22-21(13-24(25)27)20-11-5-10-17-16-7-2-1-6-15(16)12-23(22)26(17)20/h1-14H |
| InChIKey | XIDHLTVUTDWRNX-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.52 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|