About 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole
2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole (PubChem CID 58479952) has the molecular formula C28H18N4S
and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole |
| PubChem CID | 58479952 |
| Molecular Formula | C28H18N4S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole |
| SMILES | c1cncc(-c2cc(-c3cccnc3)cc(-c3ncccc3-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C28H18N4S/c1-2-10-26-25(9-1)32-28(33-26)24-8-5-13-31-27(24)23-15-21(19-6-3-11-29-17-19)14-22(16-23)20-7-4-12-30-18-20/h1-18H |
| InChIKey | OUCGECWKGIZBQN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole?
The IUPAC name of 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole (CID 58479952) is 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole?
The canonical SMILES for 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole is c1cncc(-c2cc(-c3cccnc3)cc(-c3ncccc3-c3nc4ccccc4s3)c2)c1.
What is the InChIKey of 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole?
The InChIKey is OUCGECWKGIZBQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18N4S/c1-2-10-26-25(9-1)32-28(33-26)24-8-5-13-31-27(24)23-15-21(19-6-3-11-29-17-19)14-22(16-23)20-7-4-12-30-18-20/h1-18H.
What are the key properties of 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole?
2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole has a molecular weight of 442.55 g/mol, XLogP of 7.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dipyridin-3-ylphenyl)-3-pyridinyl]-1,3-benzothiazole is sourced from PubChem (CID 58479952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).