C34H21N5O — CID 58479970
2-[4-anthracen-9-yl-6-(1-phenyl-1,2,4-triazol-3-yl)-2-pyridinyl]-1,3-benzoxazole (PubChem CID 58479970) has the molecular formula C34H21N5O and a molecular weight of 515.58 g/mol. Its IUPAC name is 2-[4-anthracen-9-yl-6-(1-phenyl-1,2,4-triazol-3-yl)-2-pyridinyl]-1,3-benzoxazole.
| Compound Name | 2-[4-anthracen-9-yl-6-(1-phenyl-1,2,4-triazol-3-yl)-2-pyridinyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 58479970 |
| Molecular Formula | C34H21N5O |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[4-anthracen-9-yl-6-(1-phenyl-1,2,4-triazol-3-yl)-2-pyridinyl]-1,3-benzoxazole |
| SMILES | c1ccc(-n2cnc(-c3cc(-c4c5ccccc5cc5ccccc45)cc(-c4nc5ccccc5o4)n3)n2)cc1 |
| InChI | InChI=1S/C34H21N5O/c1-2-12-25(13-3-1)39-21-35-33(38-39)29-19-24(20-30(36-29)34-37-28-16-8-9-17-31(28)40-34)32-26-14-6-4-10-22(26)18-23-11-5-7-15-27(23)32/h1-21H |
| InChIKey | XBPDVVZCFWTHJK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|