C32H18N4OS — CID 58479991
2-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzoxazole (PubChem CID 58479991) has the molecular formula C32H18N4OS and a molecular weight of 506.59 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 58479991 |
| Molecular Formula | C32H18N4OS |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1cnc2c(c1)cc(-c1cc(-c3nc4ccccc4o3)cc(-c3nc4ccccc4s3)c1)c1cccnc12 |
| InChI | InChI=1S/C32H18N4OS/c1-3-11-27-25(9-1)35-31(37-27)21-15-20(16-22(17-21)32-36-26-10-2-4-12-28(26)38-32)24-18-19-7-5-13-33-29(19)30-23(24)8-6-14-34-30/h1-18H |
| InChIKey | CAAWCPMRZYRUQJ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|