C45H28N6S — CID 58479995
2-[3-[3-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole (PubChem CID 58479995) has the molecular formula C45H28N6S and a molecular weight of 684.83 g/mol. Its IUPAC name is 2-[3-[3-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-[3-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 58479995 |
| Molecular Formula | C45H28N6S |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | 2-[3-[3-(4,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2nnc(-c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6cccnc6c6ncccc56)c4)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H28N6S/c1-3-12-29(13-4-1)43-49-50-44(51(43)36-17-5-2-6-18-36)32-15-9-14-30(24-32)33-25-34(27-35(26-33)45-48-39-20-7-8-21-40(39)52-45)38-28-31-16-10-22-46-41(31)42-37(38)19-11-23-47-42/h1-28H |
| InChIKey | FOKWPLAELQIXMM-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|