C46H30N6S — CID 58480049
2-[3-[3-[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole (PubChem CID 58480049) has the molecular formula C46H30N6S and a molecular weight of 698.86 g/mol. Its IUPAC name is 2-[3-[3-[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-[3-[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 58480049 |
| Molecular Formula | C46H30N6S |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.23 |
| IUPAC Name | 2-[3-[3-[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]phenyl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(-c2nnc(-c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6cccnc6c6ncccc56)c4)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H30N6S/c1-29-18-20-30(21-19-29)44-50-51-45(52(44)37-13-3-2-4-14-37)33-11-7-10-31(24-33)34-25-35(27-36(26-34)46-49-40-16-5-6-17-41(40)53-46)39-28-32-12-8-22-47-42(32)43-38(39)15-9-23-48-43/h2-28H,1H3 |
| InChIKey | HJCMAGDSGNHXDT-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|