C40H24N4OS — CID 58480082
5-[3-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]phenyl]-2-phenyl-1,3-oxazole (PubChem CID 58480082) has the molecular formula C40H24N4OS and a molecular weight of 608.73 g/mol. Its IUPAC name is 5-[3-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]phenyl]-2-phenyl-1,3-oxazole.
| Compound Name | 5-[3-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]phenyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 58480082 |
| Molecular Formula | C40H24N4OS |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 5-[3-[3-(1,3-benzothiazol-2-yl)-5-(1,10-phenanthrolin-5-yl)phenyl]phenyl]-2-phenyl-1,3-oxazole |
| SMILES | c1ccc(-c2ncc(-c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6cccnc6c6ncccc56)c4)c3)o2)cc1 |
| InChI | InChI=1S/C40H24N4OS/c1-2-9-25(10-3-1)39-43-24-35(45-39)27-12-6-11-26(19-27)29-20-30(22-31(21-29)40-44-34-15-4-5-16-36(34)46-40)33-23-28-13-7-17-41-37(28)38-32(33)14-8-18-42-38/h1-24H |
| InChIKey | QFMGEDRJPWGWSH-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|