About 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole
2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole (PubChem CID 58480109) has the molecular formula C36H21N7S
and a molecular weight of 583.68 g/mol. Its IUPAC name is 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole |
| PubChem CID | 58480109 |
| Molecular Formula | C36H21N7S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-n2c(-c3cc(-c4nc5ccccc5s4)cc(-c4cc5cccnc5c5ncccc45)c3)nc3cncnc32)cc1 |
| InChI | InChI=1S/C36H21N7S/c1-2-9-26(10-3-1)43-34(41-30-20-37-21-40-35(30)43)24-16-23(17-25(18-24)36-42-29-12-4-5-13-31(29)44-36)28-19-22-8-6-14-38-32(22)33-27(28)11-7-15-39-33/h1-21H |
| InChIKey | VMZJXBKLNJHDFR-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole?
The IUPAC name of 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole (CID 58480109) is 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole?
The canonical SMILES for 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole is c1ccc(-n2c(-c3cc(-c4nc5ccccc5s4)cc(-c4cc5cccnc5c5ncccc45)c3)nc3cncnc32)cc1.
What is the InChIKey of 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole?
The InChIKey is VMZJXBKLNJHDFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H21N7S/c1-2-9-26(10-3-1)43-34(41-30-20-37-21-40-35(30)43)24-16-23(17-25(18-24)36-42-29-12-4-5-13-31(29)44-36)28-19-22-8-6-14-38-32(22)33-27(28)11-7-15-39-33/h1-21H.
What are the key properties of 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole?
2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole has a molecular weight of 583.68 g/mol, XLogP of 8.52, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenylpurin-8-yl)phenyl]-1,3-benzothiazole is sourced from PubChem (CID 58480109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).