About 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane
4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane (PubChem CID 58481003) has the molecular formula C8H10F2O
and a molecular weight of 160.16 g/mol. Its IUPAC name is 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane.
Molecular Properties
| Compound Name | 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane |
| PubChem CID | 58481003 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane |
| SMILES | FC1(F)OC2C3CCC(C3)C21 |
| InChI | InChI=1S/C8H10F2O/c9-8(10)6-4-1-2-5(3-4)7(6)11-8/h4-7H,1-3H2 |
| InChIKey | ZHZDVQKNCIMYFG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane?
The IUPAC name of 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane (CID 58481003) is 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane.
What is the SMILES notation for 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane?
The canonical SMILES for 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane is FC1(F)OC2C3CCC(C3)C21.
What is the InChIKey of 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane?
The InChIKey is ZHZDVQKNCIMYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O/c9-8(10)6-4-1-2-5(3-4)7(6)11-8/h4-7H,1-3H2.
What are the key properties of 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane?
4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane has a molecular weight of 160.16 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-oxatricyclo[4.2.1.02,5]nonane is sourced from PubChem (CID 58481003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).