About ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate
ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate (PubChem CID 58481386) has the molecular formula C23H31ClO4
and a molecular weight of 406.95 g/mol. Its IUPAC name is ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 58481386 |
| Molecular Formula | C23H31ClO4 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)C1(CC(=O)Cc2c(C)cc(Cl)cc2C)CCC2(CCCO2)CC1 |
| InChI | InChI=1S/C23H31ClO4/c1-4-27-21(26)22(7-9-23(10-8-22)6-5-11-28-23)15-19(25)14-20-16(2)12-18(24)13-17(20)3/h12-13H,4-11,14-15H2,1-3H3 |
| InChIKey | IZIMVUYNGWRPLK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate?
The IUPAC name of ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate (CID 58481386) is ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate is CCOC(=O)C1(CC(=O)Cc2c(C)cc(Cl)cc2C)CCC2(CCCO2)CC1.
What is the InChIKey of ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate?
The InChIKey is IZIMVUYNGWRPLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31ClO4/c1-4-27-21(26)22(7-9-23(10-8-22)6-5-11-28-23)15-19(25)14-20-16(2)12-18(24)13-17(20)3/h12-13H,4-11,14-15H2,1-3H3.
What are the key properties of ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate?
ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate has a molecular weight of 406.95 g/mol, XLogP of 5.13, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-[3-(4-chloro-2,6-dimethylphenyl)-2-oxopropyl]-1-oxaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 58481386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).