C23H27F4NO3 — CID 58481433
4-[[1-(2,2,3,3-tetrafluoropropanoyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481433) has the molecular formula C23H27F4NO3 and a molecular weight of 441.47 g/mol. Its IUPAC name is 4-[[1-(2,2,3,3-tetrafluoropropanoyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[1-(2,2,3,3-tetrafluoropropanoyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481433 |
| Molecular Formula | C23H27F4NO3 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[[1-(2,2,3,3-tetrafluoropropanoyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(C(=O)C(F)(F)C(F)F)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H27F4NO3/c1-12-8-13(2)18(14(3)9-12)19-17(29)11-16(20(19)30)10-15-4-6-28(7-5-15)22(31)23(26,27)21(24)25/h8-9,15-16,19,21H,4-7,10-11H2,1-3H3 |
| InChIKey | DVPSWFHOASFOLZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|