C22H26F3NO3 — CID 58481444
4-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481444) has the molecular formula C22H26F3NO3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481444 |
| Molecular Formula | C22H26F3NO3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(C(=O)C(F)(F)F)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H26F3NO3/c1-12-8-13(2)18(14(3)9-12)19-17(27)11-16(20(19)28)10-15-4-6-26(7-5-15)21(29)22(23,24)25/h8-9,15-16,19H,4-7,10-11H2,1-3H3 |
| InChIKey | JCXXNCFNCIVREP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|