C26H25F3O3 — CID 58481491
(4E)-2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione (PubChem CID 58481491) has the molecular formula C26H25F3O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is (4E)-2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione.
| Compound Name | (4E)-2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481491 |
| Molecular Formula | C26H25F3O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (4E)-2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(C)c1C1C(=O)C/C(=C\C2CCOCC2)C1=O |
| InChI | InChI=1S/C26H25F3O3/c1-15-11-19(18-3-5-21(6-4-18)26(27,28)29)12-16(2)23(15)24-22(30)14-20(25(24)31)13-17-7-9-32-10-8-17/h3-6,11-13,17,24H,7-10,14H2,1-2H3/b20-13+ |
| InChIKey | VFQNHTMUOOHKJK-DEDYPNTBSA-N |
| XLogP | 5.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|