C25H27FO3 — CID 58481636
2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione (PubChem CID 58481636) has the molecular formula C25H27FO3 and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione.
| Compound Name | 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481636 |
| Molecular Formula | C25H27FO3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(F)cc2)cc(C)c1C1C(=O)CC(CC2CCOCC2)C1=O |
| InChI | InChI=1S/C25H27FO3/c1-15-11-19(18-3-5-21(26)6-4-18)12-16(2)23(15)24-22(27)14-20(25(24)28)13-17-7-9-29-10-8-17/h3-6,11-12,17,20,24H,7-10,13-14H2,1-2H3 |
| InChIKey | MCPWHSZLMOUMKG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|