C26H28FN3O2S — CID 58481771
5-[(1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-hydroxyethyl]-N-methylthiophene-2-carboxamide (PubChem CID 58481771) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is 5-[(1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-hydroxyethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 5-[(1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-hydroxyethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 58481771 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-[(1S)-1-[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-1-hydroxyethyl]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1ccc([C@@](C)(O)[C@H]2CCCC3=Cc4c(-c5ccc(F)cc5)ncn4C[C@@]32C)s1 |
| InChI | InChI=1S/C26H28FN3O2S/c1-25-14-30-15-29-23(16-7-9-18(27)10-8-16)19(30)13-17(25)5-4-6-21(25)26(2,32)22-12-11-20(33-22)24(31)28-3/h7-13,15,21,32H,4-6,14H2,1-3H3,(H,28,31)/t21-,25-,26-/m0/s1 |
| InChIKey | SHLLJBBKQIVTPZ-MZBJOSPHSA-N |
| XLogP | 5.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |