C24H27FN2O2 — CID 58481776
[(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(oxan-4-yl)methanone (PubChem CID 58481776) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is [(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(oxan-4-yl)methanone.
| Compound Name | [(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 58481776 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(5aR,6S)-1-(4-fluorophenyl)-5a-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-b]isoquinolin-6-yl]-(oxan-4-yl)methanone |
| SMILES | C[C@]12Cn3cnc(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2C(=O)C1CCOCC1 |
| InChI | InChI=1S/C24H27FN2O2/c1-24-14-27-15-26-22(16-5-7-19(25)8-6-16)21(27)13-18(24)3-2-4-20(24)23(28)17-9-11-29-12-10-17/h5-8,13,15,17,20H,2-4,9-12,14H2,1H3/t20-,24+/m1/s1 |
| InChIKey | REWXTOGBFUJOSL-YKSBVNFPSA-N |
| XLogP | 4.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |