About ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate
ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate (PubChem CID 58483479) has the molecular formula C16H20F3NO3
and a molecular weight of 331.33 g/mol. Its IUPAC name is ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate |
| PubChem CID | 58483479 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1cc(CNC(=O)C(C)(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO3/c1-5-23-13(21)11-8-10(6-7-12(11)16(17,18)19)9-20-14(22)15(2,3)4/h6-8H,5,9H2,1-4H3,(H,20,22) |
| InChIKey | UGBXTAWCDHGQPM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate?
The IUPAC name of ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate (CID 58483479) is ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate.
What is the SMILES notation for ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate?
The canonical SMILES for ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate is CCOC(=O)c1cc(CNC(=O)C(C)(C)C)ccc1C(F)(F)F.
What is the InChIKey of ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate?
The InChIKey is UGBXTAWCDHGQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3NO3/c1-5-23-13(21)11-8-10(6-7-12(11)16(17,18)19)9-20-14(22)15(2,3)4/h6-8H,5,9H2,1-4H3,(H,20,22).
What are the key properties of ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate?
ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate has a molecular weight of 331.33 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoate is sourced from PubChem (CID 58483479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).