C31H37N5O2 — CID 58483729
trans-(1S,2S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-2-[3-(2H-triazol-4-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 58483729) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is trans-(1S,2S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-2-[3-(2H-triazol-4-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-2-[3-(2H-triazol-4-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58483729 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | trans-(1S,2S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-2-[3-(2H-triazol-4-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CCCC[C@@H]2c2cccc(-c3cn[nH]n3)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C31H37N5O2/c1-38-17-7-16-35-20-24(27-11-4-5-13-30(27)35)21-36(25-14-15-25)31(37)28-12-3-2-10-26(28)22-8-6-9-23(18-22)29-19-32-34-33-29/h4-6,8-9,11,13,18-20,25-26,28H,2-3,7,10,12,14-17,21H2,1H3,(H,32,33,34)/t26-,28+/m1/s1 |
| InChIKey | UPQGKTUUJHXIPT-IAPPQJPRSA-N |
| XLogP | 5.93 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|