About 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole
2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole (PubChem CID 58483839) has the molecular formula C23H20N6OS
and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole |
| PubChem CID | 58483839 |
| Molecular Formula | C23H20N6OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc3ccccc3s2)c(OC[C@H]2CCCN2c2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C23H20N6OS/c1-3-9-18(16(7-1)23-28-17-8-2-4-10-19(17)31-23)30-12-15-6-5-11-29(15)22-20-21(25-13-24-20)26-14-27-22/h1-4,7-10,13-15H,5-6,11-12H2,(H,24,25,26,27)/t15-/m1/s1 |
| InChIKey | KMIMXRGHLNRYKX-OAHLLOKOSA-N |
| XLogP | 4.68 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole?
The IUPAC name of 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole (CID 58483839) is 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole?
The canonical SMILES for 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole is c1ccc(-c2nc3ccccc3s2)c(OC[C@H]2CCCN2c2ncnc3nc[nH]c23)c1.
What is the InChIKey of 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole?
The InChIKey is KMIMXRGHLNRYKX-OAHLLOKOSA-N. The full InChI is InChI=1S/C23H20N6OS/c1-3-9-18(16(7-1)23-28-17-8-2-4-10-19(17)31-23)30-12-15-6-5-11-29(15)22-20-21(25-13-24-20)26-14-27-22/h1-4,7-10,13-15H,5-6,11-12H2,(H,24,25,26,27)/t15-/m1/s1.
What are the key properties of 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole?
2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole has a molecular weight of 428.52 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]-1,3-benzothiazole is sourced from PubChem (CID 58483839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).