About tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate
tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 58483968) has the molecular formula C11H20FNO5S
and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 58483968 |
| Molecular Formula | C11H20FNO5S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C11H20FNO5S/c1-11(2,3)18-10(14)13-6-8(12)5-9(13)7-17-19(4,15)16/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | ZJCNXSGPDYORFU-DTWKUNHWSA-N |
| XLogP | 1.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (CID 58483968) is tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](F)C[C@@H]1COS(C)(=O)=O.
What is the InChIKey of tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is ZJCNXSGPDYORFU-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H20FNO5S/c1-11(2,3)18-10(14)13-6-8(12)5-9(13)7-17-19(4,15)16/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate?
tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 297.35 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,4S)-4-fluoro-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 58483968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).