C9H10F2NO2+ — CID 58484128
2,2-difluoro-5-propan-2-yl-[1,3]dioxolo[4,5-c]pyridin-5-ium (PubChem CID 58484128) has the molecular formula C9H10F2NO2+ and a molecular weight of 202.18 g/mol. Its IUPAC name is 2,2-difluoro-5-propan-2-yl-[1,3]dioxolo[4,5-c]pyridin-5-ium.
| Compound Name | 2,2-difluoro-5-propan-2-yl-[1,3]dioxolo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 58484128 |
| Molecular Formula | C9H10F2NO2+ |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2,2-difluoro-5-propan-2-yl-[1,3]dioxolo[4,5-c]pyridin-5-ium |
| SMILES | CC(C)[n+]1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H10F2NO2/c1-6(2)12-4-3-7-8(5-12)14-9(10,11)13-7/h3-6H,1-2H3/q+1 |
| InChIKey | CYLJIKLFDRTNSU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|