C11H13NOS — CID 58484401
(2S)-2,7-dimethyl-3,4-dihydro-2H-1,4-benzothiazepin-5-one (PubChem CID 58484401) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (2S)-2,7-dimethyl-3,4-dihydro-2H-1,4-benzothiazepin-5-one.
| Compound Name | (2S)-2,7-dimethyl-3,4-dihydro-2H-1,4-benzothiazepin-5-one |
|---|---|
| PubChem CID | 58484401 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2S)-2,7-dimethyl-3,4-dihydro-2H-1,4-benzothiazepin-5-one |
| SMILES | Cc1ccc2c(c1)C(=O)NC[C@H](C)S2 |
| InChI | InChI=1S/C11H13NOS/c1-7-3-4-10-9(5-7)11(13)12-6-8(2)14-10/h3-5,8H,6H2,1-2H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | VEZVLJVALOCMPN-QMMMGPOBSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |