C11H13NO2 — CID 58484806
(4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 58484806) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58484806 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OC(=O)N1C |
| InChI | InChI=1S/C11H13NO2/c1-8-10(14-11(13)12(8)2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-,10-/m1/s1 |
| InChIKey | MNYARIILPGRTQL-PSASIEDQSA-N |
| XLogP | 2.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |