C19H20N4O2 — CID 58485250
5-(cyclopropylamino)-3-(2-methylpropyl)pyrimido[4,5-c]quinoline-8-carboxylic acid (PubChem CID 58485250) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-(cyclopropylamino)-3-(2-methylpropyl)pyrimido[4,5-c]quinoline-8-carboxylic acid.
| Compound Name | 5-(cyclopropylamino)-3-(2-methylpropyl)pyrimido[4,5-c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 58485250 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-(cyclopropylamino)-3-(2-methylpropyl)pyrimido[4,5-c]quinoline-8-carboxylic acid |
| SMILES | CC(C)Cc1ncc2c(n1)c(NC1CC1)nc1cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C19H20N4O2/c1-10(2)7-16-20-9-14-13-6-3-11(19(24)25)8-15(13)22-18(17(14)23-16)21-12-4-5-12/h3,6,8-10,12H,4-5,7H2,1-2H3,(H,21,22)(H,24,25) |
| InChIKey | MISCHMWGEQHOOY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|