About 1-methoxyadamantane
1-methoxyadamantane (PubChem CID 584854) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 1-methoxyadamantane.
Molecular Properties
| Compound Name | 1-methoxyadamantane |
| PubChem CID | 584854 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 1-methoxyadamantane |
| SMILES | COC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H18O/c1-12-11-5-8-2-9(6-11)4-10(3-8)7-11/h8-10H,2-7H2,1H3 |
| InChIKey | VLBPHZFRABGLFH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxyadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyadamantane?
The IUPAC name of 1-methoxyadamantane (CID 584854) is 1-methoxyadamantane.
What is the SMILES notation for 1-methoxyadamantane?
The canonical SMILES for 1-methoxyadamantane is COC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-methoxyadamantane?
The InChIKey is VLBPHZFRABGLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-12-11-5-8-2-9(6-11)4-10(3-8)7-11/h8-10H,2-7H2,1H3.
What are the key properties of 1-methoxyadamantane?
1-methoxyadamantane has a molecular weight of 166.26 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyadamantane is sourced from PubChem (CID 584854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).