C10H14NO+ — CID 58485449
1-hydroxy-2-methyl-5,6,7,8-tetrahydroquinolin-1-ium (PubChem CID 58485449) has the molecular formula C10H14NO+ and a molecular weight of 164.23 g/mol. Its IUPAC name is 1-hydroxy-2-methyl-5,6,7,8-tetrahydroquinolin-1-ium.
| Compound Name | 1-hydroxy-2-methyl-5,6,7,8-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 58485449 |
| Molecular Formula | C10H14NO+ |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-hydroxy-2-methyl-5,6,7,8-tetrahydroquinolin-1-ium |
| SMILES | Cc1ccc2c([n+]1O)CCCC2 |
| InChI | InChI=1S/C10H14NO/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h6-7,12H,2-5H2,1H3/q+1 |
| InChIKey | PZNNATIZVDZHBM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|