C30H39FN4O2Si — CID 58485867
[2-fluoro-6-[(6-methoxy-3-pyridinyl)methyl]-3-pyridinyl]-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol (PubChem CID 58485867) has the molecular formula C30H39FN4O2Si and a molecular weight of 534.75 g/mol. Its IUPAC name is [2-fluoro-6-[(6-methoxy-3-pyridinyl)methyl]-3-pyridinyl]-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol.
| Compound Name | [2-fluoro-6-[(6-methoxy-3-pyridinyl)methyl]-3-pyridinyl]-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 58485867 |
| Molecular Formula | C30H39FN4O2Si |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [2-fluoro-6-[(6-methoxy-3-pyridinyl)methyl]-3-pyridinyl]-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
| SMILES | COc1ccc(Cc2ccc(C(O)c3cn([Si](C(C)C)(C(C)C)C(C)C)c4ncc(C)cc34)c(F)n2)cn1 |
| InChI | InChI=1S/C30H39FN4O2Si/c1-18(2)38(19(3)4,20(5)6)35-17-26(25-13-21(7)15-33-30(25)35)28(36)24-11-10-23(34-29(24)31)14-22-9-12-27(37-8)32-16-22/h9-13,15-20,28,36H,14H2,1-8H3 |
| InChIKey | PHQINTJZUCSNLM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|