C22H23N5O3 — CID 58485971
3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 58485971) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 58485971 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | CN(C)CCCOc1cnc(-c2cccc(Cn3c(=O)oc4cccnc43)c2)nc1 |
| InChI | InChI=1S/C22H23N5O3/c1-26(2)10-5-11-29-18-13-24-20(25-14-18)17-7-3-6-16(12-17)15-27-21-19(30-22(27)28)8-4-9-23-21/h3-4,6-9,12-14H,5,10-11,15H2,1-2H3 |
| InChIKey | OKLIWMXGGZRSGJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|