C21H33BN2O2 — CID 58486200
1-propan-2-yl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine (PubChem CID 58486200) has the molecular formula C21H33BN2O2 and a molecular weight of 356.32 g/mol. Its IUPAC name is 1-propan-2-yl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine.
| Compound Name | 1-propan-2-yl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine |
|---|---|
| PubChem CID | 58486200 |
| Molecular Formula | C21H33BN2O2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 1-propan-2-yl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine |
| SMILES | CC(C)N1CCN(c2ccc(/C=C/B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C21H33BN2O2/c1-17(2)23-13-15-24(16-14-23)19-9-7-18(8-10-19)11-12-22-25-20(3,4)21(5,6)26-22/h7-12,17H,13-16H2,1-6H3/b12-11+ |
| InChIKey | NHMVJASGKBZOMK-VAWYXSNFSA-N |
| XLogP | 3.86 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|