C18H14IN3O — CID 58486280
(1R,2S)-2-(3-iodo-2H-indazol-6-yl)-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 58486280) has the molecular formula C18H14IN3O and a molecular weight of 415.23 g/mol. Its IUPAC name is (1R,2S)-2-(3-iodo-2H-indazol-6-yl)-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | (1R,2S)-2-(3-iodo-2H-indazol-6-yl)-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 58486280 |
| Molecular Formula | C18H14IN3O |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | (1R,2S)-2-(3-iodo-2H-indazol-6-yl)-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@@]2(C[C@H]2c2ccc3c(I)[nH]nc3c2)c2ccccc21 |
| InChI | InChI=1S/C18H14IN3O/c1-22-15-5-3-2-4-12(15)18(17(22)23)9-13(18)10-6-7-11-14(8-10)20-21-16(11)19/h2-8,13H,9H2,1H3,(H,20,21)/t13-,18-/m0/s1 |
| InChIKey | MRJRTSPXVJGXDP-UGSOOPFHSA-N |
| XLogP | 3.57 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|