C18H14IN3O — CID 58486369
(2'S,3R)-2'-(3-iodo-2H-indazol-6-yl)-5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 58486369) has the molecular formula C18H14IN3O and a molecular weight of 415.23 g/mol. Its IUPAC name is (2'S,3R)-2'-(3-iodo-2H-indazol-6-yl)-5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3R)-2'-(3-iodo-2H-indazol-6-yl)-5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 58486369 |
| Molecular Formula | C18H14IN3O |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | (2'S,3R)-2'-(3-iodo-2H-indazol-6-yl)-5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | Cc1ccc2c(c1)[C@]1(C[C@H]1c1ccc3c(I)[nH]nc3c1)C(=O)N2 |
| InChI | InChI=1S/C18H14IN3O/c1-9-2-5-14-12(6-9)18(17(23)20-14)8-13(18)10-3-4-11-15(7-10)21-22-16(11)19/h2-7,13H,8H2,1H3,(H,20,23)(H,21,22)/t13-,18-/m0/s1 |
| InChIKey | JOYQNIVQNHAVDW-UGSOOPFHSA-N |
| XLogP | 3.85 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|