C17H21N4O2S+ — CID 58486517
(1S,3S,4S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-methylspiro[1-azoniabicyclo[2.2.1]heptane-3,5'-4H-1,3-oxazole]-2'-amine (PubChem CID 58486517) has the molecular formula C17H21N4O2S+ and a molecular weight of 345.45 g/mol. Its IUPAC name is (1S,3S,4S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-methylspiro[1-azoniabicyclo[2.2.1]heptane-3,5'-4H-1,3-oxazole]-2'-amine.
| Compound Name | (1S,3S,4S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-methylspiro[1-azoniabicyclo[2.2.1]heptane-3,5'-4H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 58486517 |
| Molecular Formula | C17H21N4O2S+ |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (1S,3S,4S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-methylspiro[1-azoniabicyclo[2.2.1]heptane-3,5'-4H-1,3-oxazole]-2'-amine |
| SMILES | COc1ccc2nc(NC3=NC[C@@]4(C[N@@+]5(C)CC[C@H]4C5)O3)sc2c1 |
| InChI | InChI=1S/C17H21N4O2S/c1-21-6-5-11(8-21)17(10-21)9-18-15(23-17)20-16-19-13-4-3-12(22-2)7-14(13)24-16/h3-4,7,11H,5-6,8-10H2,1-2H3,(H,18,19,20)/q+1/t11-,17-,21-/m0/s1 |
| InChIKey | HOBHKEHQECMECJ-XABWTFMKSA-N |
| XLogP | 2.32 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|