About N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide
N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide (PubChem CID 58486645) has the molecular formula C20H13ClF2N2O2
and a molecular weight of 386.79 g/mol. Its IUPAC name is N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide |
| PubChem CID | 58486645 |
| Molecular Formula | C20H13ClF2N2O2 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2cc3c(cc2Cl)CCO3)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H13ClF2N2O2/c21-14-8-11-6-7-27-17(11)9-13(14)12-4-5-18(24-10-12)25-20(26)19-15(22)2-1-3-16(19)23/h1-5,8-10H,6-7H2,(H,24,25,26) |
| InChIKey | MTJWOYKFQMUEAY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide?
The IUPAC name of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide (CID 58486645) is N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide is O=C(Nc1ccc(-c2cc3c(cc2Cl)CCO3)cn1)c1c(F)cccc1F.
What is the InChIKey of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide?
The InChIKey is MTJWOYKFQMUEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClF2N2O2/c21-14-8-11-6-7-27-17(11)9-13(14)12-4-5-18(24-10-12)25-20(26)19-15(22)2-1-3-16(19)23/h1-5,8-10H,6-7H2,(H,24,25,26).
What are the key properties of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide?
N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide has a molecular weight of 386.79 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)-2-pyridinyl]-2,6-difluorobenzamide is sourced from PubChem (CID 58486645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).