About N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide
N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide (PubChem CID 58486920) has the molecular formula C24H20F2N4O3
and a molecular weight of 450.45 g/mol. Its IUPAC name is N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide |
| PubChem CID | 58486920 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide |
| SMILES | COc1ccc(OC)c(-c2cc(-c3ccc(NC(=O)c4c(F)cccc4F)nc3)n(C)n2)c1 |
| InChI | InChI=1S/C24H20F2N4O3/c1-30-20(12-19(29-30)16-11-15(32-2)8-9-21(16)33-3)14-7-10-22(27-13-14)28-24(31)23-17(25)5-4-6-18(23)26/h4-13H,1-3H3,(H,27,28,31) |
| InChIKey | VHEKWSCAKQWFMK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide?
The IUPAC name of N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide (CID 58486920) is N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide is COc1ccc(OC)c(-c2cc(-c3ccc(NC(=O)c4c(F)cccc4F)nc3)n(C)n2)c1.
What is the InChIKey of N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide?
The InChIKey is VHEKWSCAKQWFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N4O3/c1-30-20(12-19(29-30)16-11-15(32-2)8-9-21(16)33-3)14-7-10-22(27-13-14)28-24(31)23-17(25)5-4-6-18(23)26/h4-13H,1-3H3,(H,27,28,31).
What are the key properties of N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide?
N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide has a molecular weight of 450.45 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[3-(2,5-dimethoxyphenyl)-1-methylpyrazol-5-yl]-2-pyridinyl]-2,6-difluorobenzamide is sourced from PubChem (CID 58486920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).