About 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide
2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide (PubChem CID 58486974) has the molecular formula C21H15ClF2N2O2
and a molecular weight of 400.81 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide |
| PubChem CID | 58486974 |
| Molecular Formula | C21H15ClF2N2O2 |
| Molecular Weight | 400.81 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide |
| SMILES | Cc1cc2c(cc1-c1ccc(NC(=O)c3ccccc3Cl)nc1)CC(F)(F)O2 |
| InChI | InChI=1S/C21H15ClF2N2O2/c1-12-8-18-14(10-21(23,24)28-18)9-16(12)13-6-7-19(25-11-13)26-20(27)15-4-2-3-5-17(15)22/h2-9,11H,10H2,1H3,(H,25,26,27) |
| InChIKey | VOTPGORLFCLYLH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide?
The IUPAC name of 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide (CID 58486974) is 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide.
What is the SMILES notation for 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide?
The canonical SMILES for 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide is Cc1cc2c(cc1-c1ccc(NC(=O)c3ccccc3Cl)nc1)CC(F)(F)O2.
What is the InChIKey of 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide?
The InChIKey is VOTPGORLFCLYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF2N2O2/c1-12-8-18-14(10-21(23,24)28-18)9-16(12)13-6-7-19(25-11-13)26-20(27)15-4-2-3-5-17(15)22/h2-9,11H,10H2,1H3,(H,25,26,27).
What are the key properties of 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide?
2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide has a molecular weight of 400.81 g/mol, XLogP of 5.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[5-(2,2-difluoro-6-methyl-3H-1-benzofuran-5-yl)-2-pyridinyl]benzamide is sourced from PubChem (CID 58486974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).