C20H11F6N3O3 — CID 58487013
2,6-difluoro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide (PubChem CID 58487013) has the molecular formula C20H11F6N3O3 and a molecular weight of 455.31 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 58487013 |
| Molecular Formula | C20H11F6N3O3 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2,6-difluoro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide |
| SMILES | Cc1cc2c(cc1-c1cnc(NC(=O)c3c(F)cccc3F)cn1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C20H11F6N3O3/c1-9-5-14-15(32-20(25,26)19(23,24)31-14)6-10(9)13-7-28-16(8-27-13)29-18(30)17-11(21)3-2-4-12(17)22/h2-8H,1H3,(H,28,29,30) |
| InChIKey | UTYZSOASMPIASG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|