C20H16F3N3O2 — CID 58487028
N-[6-amino-5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]-4-methylbenzamide (PubChem CID 58487028) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is N-[6-amino-5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]-4-methylbenzamide.
| Compound Name | N-[6-amino-5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58487028 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[6-amino-5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-c3ccccc3OC(F)(F)F)c(N)n2)cc1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-12-6-8-13(9-7-12)19(27)26-17-11-10-15(18(24)25-17)14-4-2-3-5-16(14)28-20(21,22)23/h2-11H,1H3,(H3,24,25,26,27) |
| InChIKey | WOQCBGXIPPLXKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |