C20H12ClF4N3O3 — CID 58487057
2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide (PubChem CID 58487057) has the molecular formula C20H12ClF4N3O3 and a molecular weight of 453.78 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 58487057 |
| Molecular Formula | C20H12ClF4N3O3 |
| Molecular Weight | 453.78 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)pyrazin-2-yl]benzamide |
| SMILES | Cc1cc2c(cc1-c1cnc(NC(=O)c3ccccc3Cl)cn1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C20H12ClF4N3O3/c1-10-6-15-16(31-20(24,25)19(22,23)30-15)7-12(10)14-8-27-17(9-26-14)28-18(29)11-4-2-3-5-13(11)21/h2-9H,1H3,(H,27,28,29) |
| InChIKey | KZICHDWMSDTVCP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|