About N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide
N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide (PubChem CID 58487178) has the molecular formula C19H13ClFN3O2
and a molecular weight of 369.78 g/mol. Its IUPAC name is N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide.
Molecular Properties
| Compound Name | N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide |
| PubChem CID | 58487178 |
| Molecular Formula | C19H13ClFN3O2 |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cnc(-c2cc3c(cc2Cl)CCO3)cn1)c1ccccc1F |
| InChI | InChI=1S/C19H13ClFN3O2/c20-14-7-11-5-6-26-17(11)8-13(14)16-9-23-18(10-22-16)24-19(25)12-3-1-2-4-15(12)21/h1-4,7-10H,5-6H2,(H,23,24,25) |
| InChIKey | XMFXEAIFAZSRAW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide?
The IUPAC name of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide (CID 58487178) is N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide.
What is the SMILES notation for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide?
The canonical SMILES for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide is O=C(Nc1cnc(-c2cc3c(cc2Cl)CCO3)cn1)c1ccccc1F.
What is the InChIKey of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide?
The InChIKey is XMFXEAIFAZSRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClFN3O2/c20-14-7-11-5-6-26-17(11)8-13(14)16-9-23-18(10-22-16)24-19(25)12-3-1-2-4-15(12)21/h1-4,7-10H,5-6H2,(H,23,24,25).
What are the key properties of N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide?
N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide has a molecular weight of 369.78 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(5-chloro-2,3-dihydro-1-benzofuran-6-yl)pyrazin-2-yl]-2-fluorobenzamide is sourced from PubChem (CID 58487178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).