About 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide
2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide (PubChem CID 58487210) has the molecular formula C19H11ClF2N2O3
and a molecular weight of 388.76 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide |
| PubChem CID | 58487210 |
| Molecular Formula | C19H11ClF2N2O3 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2cccc3c2OC(F)(F)O3)cn1)c1ccccc1Cl |
| InChI | InChI=1S/C19H11ClF2N2O3/c20-14-6-2-1-4-13(14)18(25)24-16-9-8-11(10-23-16)12-5-3-7-15-17(12)27-19(21,22)26-15/h1-10H,(H,23,24,25) |
| InChIKey | LQDMVVAPVKKAJF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide?
The IUPAC name of 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide (CID 58487210) is 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide.
What is the SMILES notation for 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide?
The canonical SMILES for 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide is O=C(Nc1ccc(-c2cccc3c2OC(F)(F)O3)cn1)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide?
The InChIKey is LQDMVVAPVKKAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF2N2O3/c20-14-6-2-1-4-13(14)18(25)24-16-9-8-11(10-23-16)12-5-3-7-15-17(12)27-19(21,22)26-15/h1-10H,(H,23,24,25).
What are the key properties of 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide?
2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide has a molecular weight of 388.76 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[5-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-pyridinyl]benzamide is sourced from PubChem (CID 58487210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).